C24H23ClN4O4 — CID 156532159
tert-butyl (3S)-3-[4-(4-chloro-3-ethynylphenoxy)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidine-1-carboxylate (PubChem CID 156532159) has the molecular formula C24H23ClN4O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-(4-chloro-3-ethynylphenoxy)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-(4-chloro-3-ethynylphenoxy)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156532159 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | tert-butyl (3S)-3-[4-(4-chloro-3-ethynylphenoxy)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidine-1-carboxylate |
| SMILES | C#Cc1cc(Oc2ncnc3ccc(O[C@H]4CCN(C(=O)OC(C)(C)C)C4)nc23)ccc1Cl |
| InChI | InChI=1S/C24H23ClN4O4/c1-5-15-12-16(6-7-18(15)25)32-22-21-19(26-14-27-22)8-9-20(28-21)31-17-10-11-29(13-17)23(30)33-24(2,3)4/h1,6-9,12,14,17H,10-11,13H2,2-4H3/t17-/m0/s1 |
| InChIKey | JFNLRHXGRMKFHU-KRWDZBQOSA-N |
| XLogP | 4.84 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|