C20H17BrFN5O2 — CID 156532212
1-[(3S)-3-[4-(3-bromo-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 156532212) has the molecular formula C20H17BrFN5O2 and a molecular weight of 458.29 g/mol. Its IUPAC name is 1-[(3S)-3-[4-(3-bromo-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[4-(3-bromo-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156532212 |
| Molecular Formula | C20H17BrFN5O2 |
| Molecular Weight | 458.29 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 1-[(3S)-3-[4-(3-bromo-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]oxypyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H](Oc2ccc3ncnc(Nc4cccc(Br)c4F)c3n2)C1 |
| InChI | InChI=1S/C20H17BrFN5O2/c1-2-17(28)27-9-8-12(10-27)29-16-7-6-15-19(26-16)20(24-11-23-15)25-14-5-3-4-13(21)18(14)22/h2-7,11-12H,1,8-10H2,(H,23,24,25)/t12-/m0/s1 |
| InChIKey | AKORXUKOOSKEKG-LBPRGKRZSA-N |
| XLogP | 3.84 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|