About [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane
[5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane (PubChem CID 156532344) has the molecular formula C10H16F4S
and a molecular weight of 244.30 g/mol. Its IUPAC name is [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane.
Molecular Properties
| Compound Name | [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane |
| PubChem CID | 156532344 |
| Molecular Formula | C10H16F4S |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane |
| SMILES | CC(F)(F)C1CCC=C(S(C)(F)F)CC1 |
| InChI | InChI=1S/C10H16F4S/c1-10(11,12)8-4-3-5-9(7-6-8)15(2,13)14/h5,8H,3-4,6-7H2,1-2H3 |
| InChIKey | ZADXIAGVDZZZSM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane?
The IUPAC name of [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane (CID 156532344) is [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane.
What is the SMILES notation for [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane?
The canonical SMILES for [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane is CC(F)(F)C1CCC=C(S(C)(F)F)CC1.
What is the InChIKey of [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane?
The InChIKey is ZADXIAGVDZZZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F4S/c1-10(11,12)8-4-3-5-9(7-6-8)15(2,13)14/h5,8H,3-4,6-7H2,1-2H3.
What are the key properties of [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane?
[5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane has a molecular weight of 244.30 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,1-difluoroethyl)cyclohepten-1-yl]-difluoro-methyl-λ4-sulfane is sourced from PubChem (CID 156532344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).