About (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene
(Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene (PubChem CID 156532361) has the molecular formula C10H15F3
and a molecular weight of 192.22 g/mol. Its IUPAC name is (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene.
Molecular Properties
| Compound Name | (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene |
| PubChem CID | 156532361 |
| Molecular Formula | C10H15F3 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene |
| SMILES | C=C(CC/C(C)=C\C)CC(F)(F)F |
| InChI | InChI=1S/C10H15F3/c1-4-8(2)5-6-9(3)7-10(11,12)13/h4H,3,5-7H2,1-2H3/b8-4- |
| InChIKey | GJEHFTHMKYXBBY-YWEYNIOJSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene?
The IUPAC name of (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene (CID 156532361) is (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene.
What is the SMILES notation for (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene?
The canonical SMILES for (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene is C=C(CC/C(C)=C\C)CC(F)(F)F.
What is the InChIKey of (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene?
The InChIKey is GJEHFTHMKYXBBY-YWEYNIOJSA-N. The full InChI is InChI=1S/C10H15F3/c1-4-8(2)5-6-9(3)7-10(11,12)13/h4H,3,5-7H2,1-2H3/b8-4-.
What are the key properties of (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene?
(Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene has a molecular weight of 192.22 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-8,8,8-trifluoro-3-methyl-6-methylideneoct-2-ene is sourced from PubChem (CID 156532361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).