C20H18Cl2FN5OS — CID 156532416
N-[3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropyl]-N-methylprop-2-enamide (PubChem CID 156532416) has the molecular formula C20H18Cl2FN5OS and a molecular weight of 466.37 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropyl]-N-methylprop-2-enamide.
| Compound Name | N-[3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 156532416 |
| Molecular Formula | C20H18Cl2FN5OS |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | N-[3-[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]sulfanylpropyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCSc1ccc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2n1 |
| InChI | InChI=1S/C20H18Cl2FN5OS/c1-3-16(29)28(2)9-4-10-30-15-8-7-14-19(27-15)20(25-11-24-14)26-13-6-5-12(21)17(22)18(13)23/h3,5-8,11H,1,4,9-10H2,2H3,(H,24,25,26) |
| InChIKey | CWEYLPBRLOVLSW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|