C18H27N5O5 — CID 156532615
6-[3-(6-cyanatohexyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate (PubChem CID 156532615) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 6-[3-(6-cyanatohexyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate.
| Compound Name | 6-[3-(6-cyanatohexyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate |
|---|---|
| PubChem CID | 156532615 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 6-[3-(6-cyanatohexyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate |
| SMILES | Cn1c(=O)n(CCCCCCOC#N)c(=O)n(CCCCCCOC#N)c1=O |
| InChI | InChI=1S/C18H27N5O5/c1-21-16(24)22(10-6-2-4-8-12-27-14-19)18(26)23(17(21)25)11-7-3-5-9-13-28-15-20/h2-13H2,1H3 |
| InChIKey | DYDWKJVZIDHRLZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 132.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|