C32H33ClN6O — CID 156532654
8-(4-chlorophenyl)-1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-5-[(methylideneamino)methyl]phenyl]-3-methylimidazo[4,5-c]quinolin-2-imine (PubChem CID 156532654) has the molecular formula C32H33ClN6O and a molecular weight of 553.11 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-5-[(methylideneamino)methyl]phenyl]-3-methylimidazo[4,5-c]quinolin-2-imine.
| Compound Name | 8-(4-chlorophenyl)-1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-5-[(methylideneamino)methyl]phenyl]-3-methylimidazo[4,5-c]quinolin-2-imine |
|---|---|
| PubChem CID | 156532654 |
| Molecular Formula | C32H33ClN6O |
| Molecular Weight | 553.11 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 8-(4-chlorophenyl)-1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-5-[(methylideneamino)methyl]phenyl]-3-methylimidazo[4,5-c]quinolin-2-imine |
| SMILES | [H]/N=c1\n(C)c2cnc3ccc(-c4ccc(Cl)cc4)cc3c2n1-c1cc(CN=C)c(N2CC(C)OC(C)C2)cc1C |
| InChI | InChI=1S/C32H33ClN6O/c1-19-12-29(38-17-20(2)40-21(3)18-38)24(15-35-4)14-28(19)39-31-26-13-23(22-6-9-25(33)10-7-22)8-11-27(26)36-16-30(31)37(5)32(39)34/h6-14,16,20-21,34H,4,15,17-18H2,1-3,5H3/b34-32+ |
| InChIKey | OYPZOQPHFONZMH-NWBJSICCSA-N |
| XLogP | 6.44 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.11 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|