C7H11F3N2O2S — CID 156532680
N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-sulfanylpropanamide (PubChem CID 156532680) has the molecular formula C7H11F3N2O2S and a molecular weight of 244.24 g/mol. Its IUPAC name is N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-sulfanylpropanamide.
| Compound Name | N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 156532680 |
| Molecular Formula | C7H11F3N2O2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2S/c1-4(15)6(14)11-2-5(13)12-3-7(8,9)10/h4,15H,2-3H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | ICBUEYQPRLTZLU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|