C9H9F3 — CID 156532767
(3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-3,5-dien-1-yne (PubChem CID 156532767) has the molecular formula C9H9F3 and a molecular weight of 174.16 g/mol. Its IUPAC name is (3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-3,5-dien-1-yne.
| Compound Name | (3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-3,5-dien-1-yne |
|---|---|
| PubChem CID | 156532767 |
| Molecular Formula | C9H9F3 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-3,5-dien-1-yne |
| SMILES | C#C/C(C)=C\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C9H9F3/c1-4-7(2)5-6-8(3)9(10,11)12/h1,5-6H,2-3H3/b7-5-,8-6+ |
| InChIKey | TUFMOEXIJVGIDB-CGXWXWIYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|