C10H12ClF3N4 — CID 156533017
N-tert-butyl-6-chloro-5-(2,2,2-trifluoroethanimidoyl)pyrimidin-4-amine (PubChem CID 156533017) has the molecular formula C10H12ClF3N4 and a molecular weight of 280.68 g/mol. Its IUPAC name is N-tert-butyl-6-chloro-5-(2,2,2-trifluoroethanimidoyl)pyrimidin-4-amine.
| Compound Name | N-tert-butyl-6-chloro-5-(2,2,2-trifluoroethanimidoyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 156533017 |
| Molecular Formula | C10H12ClF3N4 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-tert-butyl-6-chloro-5-(2,2,2-trifluoroethanimidoyl)pyrimidin-4-amine |
| SMILES | [H]/N=C(/c1c(Cl)ncnc1NC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N4/c1-9(2,3)18-8-5(6(15)10(12,13)14)7(11)16-4-17-8/h4,15H,1-3H3,(H,16,17,18)/b15-6- |
| InChIKey | SRWCKBJMCZKBSO-UUASQNMZSA-N |
| XLogP | 3.27 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|