C15H23F3N2O3 — CID 156533054
2,2,2-trifluoro-N-[2-[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyethylamino]-2-oxoethyl]acetamide (PubChem CID 156533054) has the molecular formula C15H23F3N2O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 156533054 |
| Molecular Formula | C15H23F3N2O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyethylamino]-2-oxoethyl]acetamide |
| SMILES | C/C1=C/C(OCCNC(=O)CNC(=O)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C15H23F3N2O3/c1-11-5-3-2-4-6-12(9-11)23-8-7-19-13(21)10-20-14(22)15(16,17)18/h9,12H,2-8,10H2,1H3,(H,19,21)(H,20,22)/b11-9- |
| InChIKey | DPIORXGITVKGAU-LUAWRHEFSA-N |
| XLogP | 2.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|