About (4R)-3,3-difluoro-4-iodocyclooctyne
(4R)-3,3-difluoro-4-iodocyclooctyne (PubChem CID 156533064) has the molecular formula C8H9F2I
and a molecular weight of 270.06 g/mol. Its IUPAC name is (4R)-3,3-difluoro-4-iodocyclooctyne.
Molecular Properties
| Compound Name | (4R)-3,3-difluoro-4-iodocyclooctyne |
| PubChem CID | 156533064 |
| Molecular Formula | C8H9F2I |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | (4R)-3,3-difluoro-4-iodocyclooctyne |
| SMILES | FC1(F)C#CCCCC[C@H]1I |
| InChI | InChI=1S/C8H9F2I/c9-8(10)6-4-2-1-3-5-7(8)11/h7H,1-3,5H2/t7-/m1/s1 |
| InChIKey | VJNGZACRXUGEPX-SSDOTTSWSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3,3-difluoro-4-iodocyclooctyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,3-difluoro-4-iodocyclooctyne?
The IUPAC name of (4R)-3,3-difluoro-4-iodocyclooctyne (CID 156533064) is (4R)-3,3-difluoro-4-iodocyclooctyne.
What is the SMILES notation for (4R)-3,3-difluoro-4-iodocyclooctyne?
The canonical SMILES for (4R)-3,3-difluoro-4-iodocyclooctyne is FC1(F)C#CCCCC[C@H]1I.
What is the InChIKey of (4R)-3,3-difluoro-4-iodocyclooctyne?
The InChIKey is VJNGZACRXUGEPX-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H9F2I/c9-8(10)6-4-2-1-3-5-7(8)11/h7H,1-3,5H2/t7-/m1/s1.
What are the key properties of (4R)-3,3-difluoro-4-iodocyclooctyne?
(4R)-3,3-difluoro-4-iodocyclooctyne has a molecular weight of 270.06 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,3-difluoro-4-iodocyclooctyne is sourced from PubChem (CID 156533064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).