C22H14O8 — CID 156533067
4-[3-[(1,3-dioxo-3a,7a-dihydro-2-benzofuran-4-yl)oxy]phenoxy]-3a,7a-dihydro-2-benzofuran-1,3-dione (PubChem CID 156533067) has the molecular formula C22H14O8 and a molecular weight of 406.35 g/mol. Its IUPAC name is 4-[3-[(1,3-dioxo-3a,7a-dihydro-2-benzofuran-4-yl)oxy]phenoxy]-3a,7a-dihydro-2-benzofuran-1,3-dione.
| Compound Name | 4-[3-[(1,3-dioxo-3a,7a-dihydro-2-benzofuran-4-yl)oxy]phenoxy]-3a,7a-dihydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 156533067 |
| Molecular Formula | C22H14O8 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 4-[3-[(1,3-dioxo-3a,7a-dihydro-2-benzofuran-4-yl)oxy]phenoxy]-3a,7a-dihydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2C(Oc3cccc(OC4=CC=CC5C(=O)OC(=O)C45)c3)=CC=CC12 |
| InChI | InChI=1S/C22H14O8/c23-19-13-6-2-8-15(17(13)21(25)29-19)27-11-4-1-5-12(10-11)28-16-9-3-7-14-18(16)22(26)30-20(14)24/h1-10,13-14,17-18H |
| InChIKey | WLRBHZMJJUAOAX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|