C23H23F2N5O2 — CID 156533089
[6-(2,2-difluorocyclopropyl)imidazo[1,2-a]pyrimidin-2-yl]-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone (PubChem CID 156533089) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is [6-(2,2-difluorocyclopropyl)imidazo[1,2-a]pyrimidin-2-yl]-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone.
| Compound Name | [6-(2,2-difluorocyclopropyl)imidazo[1,2-a]pyrimidin-2-yl]-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 156533089 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [6-(2,2-difluorocyclopropyl)imidazo[1,2-a]pyrimidin-2-yl]-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone |
| SMILES | O=C(c1cn2cc(C3CC3(F)F)cnc2n1)N1CC[C@]2(Cc3ccccc3CN2)[C@H](O)C1 |
| InChI | InChI=1S/C23H23F2N5O2/c24-23(25)8-17(23)16-9-26-21-28-18(12-30(21)11-16)20(32)29-6-5-22(19(31)13-29)7-14-3-1-2-4-15(14)10-27-22/h1-4,9,11-12,17,19,27,31H,5-8,10,13H2/t17?,19-,22+/m1/s1 |
| InChIKey | SNRZOXWAONWHOQ-BIVZGKPNSA-N |
| XLogP | 2.14 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |