C22H24ClN5O2 — CID 156533155
(4-chloro-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl)-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone (PubChem CID 156533155) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is (4-chloro-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl)-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone.
| Compound Name | (4-chloro-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl)-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 156533155 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (4-chloro-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl)-[(3R,3'R)-3'-hydroxyspiro[2,4-dihydro-1H-isoquinoline-3,4'-piperidine]-1'-yl]methanone |
| SMILES | Cc1nn(C)c2ncc(C(=O)N3CC[C@]4(Cc5ccccc5CN4)[C@H](O)C3)c(Cl)c12 |
| InChI | InChI=1S/C22H24ClN5O2/c1-13-18-19(23)16(11-24-20(18)27(2)26-13)21(30)28-8-7-22(17(29)12-28)9-14-5-3-4-6-15(14)10-25-22/h3-6,11,17,25,29H,7-10,12H2,1-2H3/t17-,22+/m1/s1 |
| InChIKey | UYTLRJLMEUEYGZ-VGSWGCGISA-N |
| XLogP | 2.22 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |