C15H14F6N4O2 — CID 156533253
1-[6-(methoxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)hydrazine (PubChem CID 156533253) has the molecular formula C15H14F6N4O2 and a molecular weight of 396.29 g/mol. Its IUPAC name is 1-[6-(methoxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)hydrazine.
| Compound Name | 1-[6-(methoxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)hydrazine |
|---|---|
| PubChem CID | 156533253 |
| Molecular Formula | C15H14F6N4O2 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[6-(methoxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)hydrazine |
| SMILES | COCc1nc(NNCC(F)(F)F)cnc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F6N4O2/c1-26-7-11-13(9-2-4-10(5-3-9)27-15(19,20)21)22-6-12(24-11)25-23-8-14(16,17)18/h2-6,23H,7-8H2,1H3,(H,24,25) |
| InChIKey | RDRFVHUMIIAWRN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|