C16H28N4O2 — CID 156533567
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(hexylamino)-1H-pyrimidin-6-one (PubChem CID 156533567) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(hexylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(hexylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 156533567 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(hexylamino)-1H-pyrimidin-6-one |
| SMILES | CCCCCCNc1nc(N2C[C@H](C)O[C@@H](C)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H28N4O2/c1-4-5-6-7-8-17-16-18-14(9-15(21)19-16)20-10-12(2)22-13(3)11-20/h9,12-13H,4-8,10-11H2,1-3H3,(H2,17,18,19,21)/t12-,13-/m0/s1 |
| InChIKey | PGPPDEFUJGHMPA-STQMWFEESA-N |
| XLogP | 2.38 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|