C25H33N7O5 — CID 156535635
N-[2-(2-azidoethoxy)ethyl]-2-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]acetamide (PubChem CID 156535635) has the molecular formula C25H33N7O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is N-[2-(2-azidoethoxy)ethyl]-2-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]acetamide.
| Compound Name | N-[2-(2-azidoethoxy)ethyl]-2-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 156535635 |
| Molecular Formula | C25H33N7O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | N-[2-(2-azidoethoxy)ethyl]-2-[[4-(1,6-dimethyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-2,6-dimethoxyphenyl]methyl-methylamino]acetamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3c2ccn3C)cc(OC)c1CN(C)CC(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C25H33N7O5/c1-30(16-23(33)27-7-10-37-11-8-28-29-26)14-20-21(35-4)12-17(13-22(20)36-5)19-15-32(3)25(34)24-18(19)6-9-31(24)2/h6,9,12-13,15H,7-8,10-11,14,16H2,1-5H3,(H,27,33) |
| InChIKey | ZJSUIZBARHYXTQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|