C25H29N5O2S2 — CID 156536179
1-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-9-yl]-3-pyridin-3-ylthiourea (PubChem CID 156536179) has the molecular formula C25H29N5O2S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 1-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-9-yl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-9-yl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 156536179 |
| Molecular Formula | C25H29N5O2S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 1-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-9-yl]-3-pyridin-3-ylthiourea |
| SMILES | CC(C)CNS(=O)(=O)c1cc2c(c3cnc(C4CC4)cc13)C(NC(=S)Nc1cccnc1)CC2 |
| InChI | InChI=1S/C25H29N5O2S2/c1-15(2)12-28-34(31,32)23-10-17-7-8-21(30-25(33)29-18-4-3-9-26-13-18)24(17)20-14-27-22(11-19(20)23)16-5-6-16/h3-4,9-11,13-16,21,28H,5-8,12H2,1-2H3,(H2,29,30,33) |
| InChIKey | JOZNDKMDQZSJNM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|