C16H12F2N6 — CID 156536293
7-fluoro-5-N-(3-fluorophenyl)-5-N-methyl-[1,2,4]triazolo[4,3-a]quinazoline-5,8-diamine (PubChem CID 156536293) has the molecular formula C16H12F2N6 and a molecular weight of 326.31 g/mol. Its IUPAC name is 7-fluoro-5-N-(3-fluorophenyl)-5-N-methyl-[1,2,4]triazolo[4,3-a]quinazoline-5,8-diamine.
| Compound Name | 7-fluoro-5-N-(3-fluorophenyl)-5-N-methyl-[1,2,4]triazolo[4,3-a]quinazoline-5,8-diamine |
|---|---|
| PubChem CID | 156536293 |
| Molecular Formula | C16H12F2N6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 7-fluoro-5-N-(3-fluorophenyl)-5-N-methyl-[1,2,4]triazolo[4,3-a]quinazoline-5,8-diamine |
| SMILES | CN(c1cccc(F)c1)c1nc2nncn2c2cc(N)c(F)cc12 |
| InChI | InChI=1S/C16H12F2N6/c1-23(10-4-2-3-9(17)5-10)15-11-6-12(18)13(19)7-14(11)24-8-20-22-16(24)21-15/h2-8H,19H2,1H3 |
| InChIKey | UJCMCLHELGJJOD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|