C24H15ClF7N5 — CID 156536296
8-chloro-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156536296) has the molecular formula C24H15ClF7N5 and a molecular weight of 541.86 g/mol. Its IUPAC name is 8-chloro-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | 8-chloro-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156536296 |
| Molecular Formula | C24H15ClF7N5 |
| Molecular Weight | 541.86 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 8-chloro-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | Cc1nnc2nc(N(CC(F)(F)F)c3cc(F)cc(C#CC4(C(F)(F)F)CC4)c3)c3ccc(Cl)cc3n12 |
| InChI | InChI=1S/C24H15ClF7N5/c1-13-34-35-21-33-20(18-3-2-15(25)10-19(18)37(13)21)36(12-23(27,28)29)17-9-14(8-16(26)11-17)4-5-22(6-7-22)24(30,31)32/h2-3,8-11H,6-7,12H2,1H3 |
| InChIKey | LQKCUDNBFJCLTR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.86 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|