C23H19FN6 — CID 156536320
5-[5-(2-cyclopropylethynyl)-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine (PubChem CID 156536320) has the molecular formula C23H19FN6 and a molecular weight of 398.45 g/mol. Its IUPAC name is 5-[5-(2-cyclopropylethynyl)-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine.
| Compound Name | 5-[5-(2-cyclopropylethynyl)-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine |
|---|---|
| PubChem CID | 156536320 |
| Molecular Formula | C23H19FN6 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 5-[5-(2-cyclopropylethynyl)-3,4-dihydro-2H-quinolin-1-yl]-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine |
| SMILES | Nc1cc2c(cc1F)c(N1CCCc3c(C#CC4CC4)cccc31)nc1nncn12 |
| InChI | InChI=1S/C23H19FN6/c24-18-11-17-21(12-19(18)25)30-13-26-28-23(30)27-22(17)29-10-2-4-16-15(3-1-5-20(16)29)9-8-14-6-7-14/h1,3,5,11-14H,2,4,6-7,10,25H2 |
| InChIKey | NHNPDBBVSGXZKJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|