C24H19F6N5 — CID 156536568
N-(2,2-difluoroethyl)-6-fluoro-1-methyl-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156536568) has the molecular formula C24H19F6N5 and a molecular weight of 491.44 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-fluoro-1-methyl-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | N-(2,2-difluoroethyl)-6-fluoro-1-methyl-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156536568 |
| Molecular Formula | C24H19F6N5 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-fluoro-1-methyl-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | Cc1nnc2nc(N(CC(F)F)c3cccc(C#CC(C)(C)C(F)(F)F)c3)c3c(F)cccc3n12 |
| InChI | InChI=1S/C24H19F6N5/c1-14-32-33-22-31-21(20-17(25)8-5-9-18(20)35(14)22)34(13-19(26)27)16-7-4-6-15(12-16)10-11-23(2,3)24(28,29)30/h4-9,12,19H,13H2,1-3H3 |
| InChIKey | ZYSMQZJPAMINAZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|