C28H32N6O2S — CID 156536599
1-cyano-2-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-7-yl]-3-(4-methylphenyl)guanidine (PubChem CID 156536599) has the molecular formula C28H32N6O2S and a molecular weight of 516.67 g/mol. Its IUPAC name is 1-cyano-2-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-7-yl]-3-(4-methylphenyl)guanidine.
| Compound Name | 1-cyano-2-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-7-yl]-3-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 156536599 |
| Molecular Formula | C28H32N6O2S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-cyano-2-[3-cyclopropyl-5-(2-methylpropylsulfamoyl)-8,9-dihydro-7H-cyclopenta[h]isoquinolin-7-yl]-3-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(=N/C2CCc3c2cc(S(=O)(=O)NCC(C)C)c2cc(C4CC4)ncc32)NC#N)cc1 |
| InChI | InChI=1S/C28H32N6O2S/c1-17(2)14-32-37(35,36)27-13-22-21(24-15-30-26(12-23(24)27)19-6-7-19)10-11-25(22)34-28(31-16-29)33-20-8-4-18(3)5-9-20/h4-5,8-9,12-13,15,17,19,25,32H,6-7,10-11,14H2,1-3H3,(H2,31,33,34) |
| InChIKey | BUILEPQIOHBPNB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|