About disodium;1-(2-nitrophenyl)ethyl phosphate
disodium;1-(2-nitrophenyl)ethyl phosphate (PubChem CID 15653666) has the molecular formula C8H8NNa2O6P
and a molecular weight of 291.11 g/mol. Its IUPAC name is disodium;1-(2-nitrophenyl)ethyl phosphate.
Molecular Properties
| Compound Name | disodium;1-(2-nitrophenyl)ethyl phosphate |
| PubChem CID | 15653666 |
| Molecular Formula | C8H8NNa2O6P |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | disodium;1-(2-nitrophenyl)ethyl phosphate |
| SMILES | CC(OP(=O)([O-])[O-])c1ccccc1[N+](=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H10NO6P.2Na/c1-6(15-16(12,13)14)7-4-2-3-5-8(7)9(10)11;;/h2-6H,1H3,(H2,12,13,14);;/q;2*+1/p-2 |
| InChIKey | BBKGGKPOEWTPIK-UHFFFAOYSA-L |
| XLogP | -5.49 |
| TPSA | 115.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;1-(2-nitrophenyl)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;1-(2-nitrophenyl)ethyl phosphate?
The IUPAC name of disodium;1-(2-nitrophenyl)ethyl phosphate (CID 15653666) is disodium;1-(2-nitrophenyl)ethyl phosphate.
What is the SMILES notation for disodium;1-(2-nitrophenyl)ethyl phosphate?
The canonical SMILES for disodium;1-(2-nitrophenyl)ethyl phosphate is CC(OP(=O)([O-])[O-])c1ccccc1[N+](=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;1-(2-nitrophenyl)ethyl phosphate?
The InChIKey is BBKGGKPOEWTPIK-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10NO6P.2Na/c1-6(15-16(12,13)14)7-4-2-3-5-8(7)9(10)11;;/h2-6H,1H3,(H2,12,13,14);;/q;2*+1/p-2.
What are the key properties of disodium;1-(2-nitrophenyl)ethyl phosphate?
disodium;1-(2-nitrophenyl)ethyl phosphate has a molecular weight of 291.11 g/mol, XLogP of -5.49, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;1-(2-nitrophenyl)ethyl phosphate is sourced from PubChem (CID 15653666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).