C25H20F5N5 — CID 156536708
7-fluoro-5-[7-fluoro-5-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)-3,4-dihydro-2H-quinolin-1-yl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazoline (PubChem CID 156536708) has the molecular formula C25H20F5N5 and a molecular weight of 485.46 g/mol. Its IUPAC name is 7-fluoro-5-[7-fluoro-5-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)-3,4-dihydro-2H-quinolin-1-yl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazoline.
| Compound Name | 7-fluoro-5-[7-fluoro-5-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)-3,4-dihydro-2H-quinolin-1-yl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazoline |
|---|---|
| PubChem CID | 156536708 |
| Molecular Formula | C25H20F5N5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 7-fluoro-5-[7-fluoro-5-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)-3,4-dihydro-2H-quinolin-1-yl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazoline |
| SMILES | Cc1nnc2nc(N3CCCc4c(C#CC(C)(C)C(F)(F)F)cc(F)cc43)c3cc(F)ccc3n12 |
| InChI | InChI=1S/C25H20F5N5/c1-14-32-33-23-31-22(19-12-16(26)6-7-20(19)35(14)23)34-10-4-5-18-15(11-17(27)13-21(18)34)8-9-24(2,3)25(28,29)30/h6-7,11-13H,4-5,10H2,1-3H3 |
| InChIKey | BDMLJNYQXMGWGW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|