C21H19FN6 — CID 156536981
5-(5-cyclopropyl-3,4-dihydro-2H-quinolin-1-yl)-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine (PubChem CID 156536981) has the molecular formula C21H19FN6 and a molecular weight of 374.42 g/mol. Its IUPAC name is 5-(5-cyclopropyl-3,4-dihydro-2H-quinolin-1-yl)-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine.
| Compound Name | 5-(5-cyclopropyl-3,4-dihydro-2H-quinolin-1-yl)-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine |
|---|---|
| PubChem CID | 156536981 |
| Molecular Formula | C21H19FN6 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-(5-cyclopropyl-3,4-dihydro-2H-quinolin-1-yl)-7-fluoro-[1,2,4]triazolo[4,3-a]quinazolin-8-amine |
| SMILES | Nc1cc2c(cc1F)c(N1CCCc3c(C4CC4)cccc31)nc1nncn12 |
| InChI | InChI=1S/C21H19FN6/c22-16-9-15-19(10-17(16)23)28-11-24-26-21(28)25-20(15)27-8-2-4-14-13(12-6-7-12)3-1-5-18(14)27/h1,3,5,9-12H,2,4,6-8,23H2 |
| InChIKey | LJCQBYLLVFVWGV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|