C15H16ClN3O — CID 156537336
4-chloro-8-ethyl-2,6,6-trimethylpyrrolo[3,2-g]quinazolin-7-one (PubChem CID 156537336) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is 4-chloro-8-ethyl-2,6,6-trimethylpyrrolo[3,2-g]quinazolin-7-one.
| Compound Name | 4-chloro-8-ethyl-2,6,6-trimethylpyrrolo[3,2-g]quinazolin-7-one |
|---|---|
| PubChem CID | 156537336 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-chloro-8-ethyl-2,6,6-trimethylpyrrolo[3,2-g]quinazolin-7-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc3c(Cl)nc(C)nc3cc21 |
| InChI | InChI=1S/C15H16ClN3O/c1-5-19-12-7-11-9(13(16)18-8(2)17-11)6-10(12)15(3,4)14(19)20/h6-7H,5H2,1-4H3 |
| InChIKey | VSFOVOFBSFUKEQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |