C15H13F3N2O3 — CID 156537541
2-[[3-[4-(3,3,3-trifluoropropyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 156537541) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-[[3-[4-(3,3,3-trifluoropropyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[4-(3,3,3-trifluoropropyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156537541 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[[3-[4-(3,3,3-trifluoropropyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1nc(-c2ccc(CCC(F)(F)F)cc2)no1)C(=O)O |
| InChI | InChI=1S/C15H13F3N2O3/c1-9(14(21)22)8-12-19-13(20-23-12)11-4-2-10(3-5-11)6-7-15(16,17)18/h2-5H,1,6-8H2,(H,21,22) |
| InChIKey | SVSLWWYRGQDCKR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|