C17H18F2N2O3 — CID 156537567
2-[[3-[4-(1,1-difluoropentyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 156537567) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[[3-[4-(1,1-difluoropentyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[4-(1,1-difluoropentyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156537567 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[[3-[4-(1,1-difluoropentyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1nc(-c2ccc(C(F)(F)CCCC)cc2)no1)C(=O)O |
| InChI | InChI=1S/C17H18F2N2O3/c1-3-4-9-17(18,19)13-7-5-12(6-8-13)15-20-14(24-21-15)10-11(2)16(22)23/h5-8H,2-4,9-10H2,1H3,(H,22,23) |
| InChIKey | BVLPQTZGQQCBQS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|