C25H37F2N2O6P — CID 156537569
tert-butyl 2-diethoxyphosphoryl-3-[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 156537569) has the molecular formula C25H37F2N2O6P and a molecular weight of 530.55 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 156537569 |
| Molecular Formula | C25H37F2N2O6P |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CCCCC(F)(F)c1ccc(Cc2noc(CC(C(=O)OC(C)(C)C)P(=O)(OCC)OCC)n2)cc1 |
| InChI | InChI=1S/C25H37F2N2O6P/c1-7-10-15-25(26,27)19-13-11-18(12-14-19)16-21-28-22(35-29-21)17-20(23(30)34-24(4,5)6)36(31,32-8-2)33-9-3/h11-14,20H,7-10,15-17H2,1-6H3 |
| InChIKey | NUJKZGIBSSBKIR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|