C22H30FN2O6P — CID 156537593
tert-butyl 2-diethoxyphosphoryl-3-[3-[1-(4-fluorophenyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 156537593) has the molecular formula C22H30FN2O6P and a molecular weight of 468.46 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-[3-[1-(4-fluorophenyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[1-(4-fluorophenyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 156537593 |
| Molecular Formula | C22H30FN2O6P |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[1-(4-fluorophenyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CCOP(=O)(OCC)C(Cc1nc(C2(c3ccc(F)cc3)CC2)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30FN2O6P/c1-6-28-32(27,29-7-2)17(19(26)30-21(3,4)5)14-18-24-20(25-31-18)22(12-13-22)15-8-10-16(23)11-9-15/h8-11,17H,6-7,12-14H2,1-5H3 |
| InChIKey | YDORRRFNRWWBDX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|