About 8,8,9-trifluoro-N'-hydroxynonanimidamide
8,8,9-trifluoro-N'-hydroxynonanimidamide (PubChem CID 156537621) has the molecular formula C9H17F3N2O
and a molecular weight of 226.24 g/mol. Its IUPAC name is 8,8,9-trifluoro-N'-hydroxynonanimidamide.
Molecular Properties
| Compound Name | 8,8,9-trifluoro-N'-hydroxynonanimidamide |
| PubChem CID | 156537621 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 8,8,9-trifluoro-N'-hydroxynonanimidamide |
| SMILES | N/C(CCCCCCC(F)(F)CF)=N\O |
| InChI | InChI=1S/C9H17F3N2O/c10-7-9(11,12)6-4-2-1-3-5-8(13)14-15/h15H,1-7H2,(H2,13,14) |
| InChIKey | IFUQUALLJGPUGS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8,8,9-trifluoro-N'-hydroxynonanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8,9-trifluoro-N'-hydroxynonanimidamide?
The IUPAC name of 8,8,9-trifluoro-N'-hydroxynonanimidamide (CID 156537621) is 8,8,9-trifluoro-N'-hydroxynonanimidamide.
What is the SMILES notation for 8,8,9-trifluoro-N'-hydroxynonanimidamide?
The canonical SMILES for 8,8,9-trifluoro-N'-hydroxynonanimidamide is N/C(CCCCCCC(F)(F)CF)=N\O.
What is the InChIKey of 8,8,9-trifluoro-N'-hydroxynonanimidamide?
The InChIKey is IFUQUALLJGPUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O/c10-7-9(11,12)6-4-2-1-3-5-8(13)14-15/h15H,1-7H2,(H2,13,14).
What are the key properties of 8,8,9-trifluoro-N'-hydroxynonanimidamide?
8,8,9-trifluoro-N'-hydroxynonanimidamide has a molecular weight of 226.24 g/mol, XLogP of 2.68, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8,9-trifluoro-N'-hydroxynonanimidamide is sourced from PubChem (CID 156537621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).