C17H15F3N2O3 — CID 156537635
2-methylidene-3-[3-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-1,2,4-oxadiazol-5-yl]butanoic acid (PubChem CID 156537635) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is 2-methylidene-3-[3-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-1,2,4-oxadiazol-5-yl]butanoic acid.
| Compound Name | 2-methylidene-3-[3-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-1,2,4-oxadiazol-5-yl]butanoic acid |
|---|---|
| PubChem CID | 156537635 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-methylidene-3-[3-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]-1,2,4-oxadiazol-5-yl]butanoic acid |
| SMILES | C=C(C(=O)O)C(C)c1nc(C2(c3ccc(C(F)(F)F)cc3)CC2)no1 |
| InChI | InChI=1S/C17H15F3N2O3/c1-9(10(2)14(23)24)13-21-15(22-25-13)16(7-8-16)11-3-5-12(6-4-11)17(18,19)20/h3-6,9H,2,7-8H2,1H3,(H,23,24) |
| InChIKey | BJEIDDCHDQVSRJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|