C24H18F2N6 — CID 156537657
7-fluoro-5-[5-(4-fluorophenyl)-3,4-dihydro-2H-quinolin-1-yl]-[1,2,4]triazolo[4,3-a]quinazolin-8-amine (PubChem CID 156537657) has the molecular formula C24H18F2N6 and a molecular weight of 428.45 g/mol. Its IUPAC name is 7-fluoro-5-[5-(4-fluorophenyl)-3,4-dihydro-2H-quinolin-1-yl]-[1,2,4]triazolo[4,3-a]quinazolin-8-amine.
| Compound Name | 7-fluoro-5-[5-(4-fluorophenyl)-3,4-dihydro-2H-quinolin-1-yl]-[1,2,4]triazolo[4,3-a]quinazolin-8-amine |
|---|---|
| PubChem CID | 156537657 |
| Molecular Formula | C24H18F2N6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 7-fluoro-5-[5-(4-fluorophenyl)-3,4-dihydro-2H-quinolin-1-yl]-[1,2,4]triazolo[4,3-a]quinazolin-8-amine |
| SMILES | Nc1cc2c(cc1F)c(N1CCCc3c(-c4ccc(F)cc4)cccc31)nc1nncn12 |
| InChI | InChI=1S/C24H18F2N6/c25-15-8-6-14(7-9-15)16-3-1-5-21-17(16)4-2-10-31(21)23-18-11-19(26)20(27)12-22(18)32-13-28-30-24(32)29-23/h1,3,5-9,11-13H,2,4,10,27H2 |
| InChIKey | UDUXKJXPCWBBBK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|