C9H15F5N2O — CID 156537682
7,7,9,9,9-pentafluoro-N'-hydroxynonanimidamide (PubChem CID 156537682) has the molecular formula C9H15F5N2O and a molecular weight of 262.22 g/mol. Its IUPAC name is 7,7,9,9,9-pentafluoro-N'-hydroxynonanimidamide.
| Compound Name | 7,7,9,9,9-pentafluoro-N'-hydroxynonanimidamide |
|---|---|
| PubChem CID | 156537682 |
| Molecular Formula | C9H15F5N2O |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 7,7,9,9,9-pentafluoro-N'-hydroxynonanimidamide |
| SMILES | N/C(CCCCCC(F)(F)CC(F)(F)F)=N\O |
| InChI | InChI=1S/C9H15F5N2O/c10-8(11,6-9(12,13)14)5-3-1-2-4-7(15)16-17/h17H,1-6H2,(H2,15,16) |
| InChIKey | CEWKKLXNZUJXKH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|