C24H35F2N2O6P — CID 156537706
tert-butyl 3-[3-[(4-butylphenyl)-difluoromethyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate (PubChem CID 156537706) has the molecular formula C24H35F2N2O6P and a molecular weight of 516.52 g/mol. Its IUPAC name is tert-butyl 3-[3-[(4-butylphenyl)-difluoromethyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate.
| Compound Name | tert-butyl 3-[3-[(4-butylphenyl)-difluoromethyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 156537706 |
| Molecular Formula | C24H35F2N2O6P |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | tert-butyl 3-[3-[(4-butylphenyl)-difluoromethyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate |
| SMILES | CCCCc1ccc(C(F)(F)c2noc(CC(C(=O)OC(C)(C)C)P(=O)(OCC)OCC)n2)cc1 |
| InChI | InChI=1S/C24H35F2N2O6P/c1-7-10-11-17-12-14-18(15-13-17)24(25,26)22-27-20(34-28-22)16-19(21(29)33-23(4,5)6)35(30,31-8-2)32-9-3/h12-15,19H,7-11,16H2,1-6H3 |
| InChIKey | TYRSMQLPMXWQJX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|