C20H26F2IN2O6P — CID 156537729
tert-butyl 2-diethoxyphosphoryl-3-[3-[difluoro-(4-iodophenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 156537729) has the molecular formula C20H26F2IN2O6P and a molecular weight of 586.31 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-[3-[difluoro-(4-iodophenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[difluoro-(4-iodophenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 156537729 |
| Molecular Formula | C20H26F2IN2O6P |
| Molecular Weight | 586.31 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[difluoro-(4-iodophenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CCOP(=O)(OCC)C(Cc1nc(C(F)(F)c2ccc(I)cc2)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26F2IN2O6P/c1-6-28-32(27,29-7-2)15(17(26)30-19(3,4)5)12-16-24-18(25-31-16)20(21,22)13-8-10-14(23)11-9-13/h8-11,15H,6-7,12H2,1-5H3 |
| InChIKey | YNEUOVDTHYEPIG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|