About tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate
tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate (PubChem CID 156537752) has the molecular formula C19H32N2O3
and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate |
| PubChem CID | 156537752 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(CCCCCCCCC)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O3/c1-6-7-8-9-10-11-12-13-16-20-17(24-21-16)14-15(2)18(22)23-19(3,4)5/h2,6-14H2,1,3-5H3 |
| InChIKey | QNGNOIUVHGAMNA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate?
The IUPAC name of tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate (CID 156537752) is tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate.
What is the SMILES notation for tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate?
The canonical SMILES for tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate is C=C(Cc1nc(CCCCCCCCC)no1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate?
The InChIKey is QNGNOIUVHGAMNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O3/c1-6-7-8-9-10-11-12-13-16-20-17(24-21-16)14-15(2)18(22)23-19(3,4)5/h2,6-14H2,1,3-5H3.
What are the key properties of tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate?
tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate has a molecular weight of 336.48 g/mol, XLogP of 4.80, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3-nonyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enoate is sourced from PubChem (CID 156537752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).