C13H9Cl2FN2O3 — CID 156537756
2-[[3-[(3,5-dichloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 156537756) has the molecular formula C13H9Cl2FN2O3 and a molecular weight of 331.13 g/mol. Its IUPAC name is 2-[[3-[(3,5-dichloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[(3,5-dichloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156537756 |
| Molecular Formula | C13H9Cl2FN2O3 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-[[3-[(3,5-dichloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1nc(Cc2cc(Cl)c(F)c(Cl)c2)no1)C(=O)O |
| InChI | InChI=1S/C13H9Cl2FN2O3/c1-6(13(19)20)2-11-17-10(18-21-11)5-7-3-8(14)12(16)9(15)4-7/h3-4H,1-2,5H2,(H,19,20) |
| InChIKey | GAGBXJFJTWUPMO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|