C22H28F2N2O3 — CID 156537857
tert-butyl 2-[[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate (PubChem CID 156537857) has the molecular formula C22H28F2N2O3 and a molecular weight of 406.47 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 156537857 |
| Molecular Formula | C22H28F2N2O3 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | tert-butyl 2-[[3-[[4-(1,1-difluoropentyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(Cc2ccc(C(F)(F)CCCC)cc2)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28F2N2O3/c1-6-7-12-22(23,24)17-10-8-16(9-11-17)14-18-25-19(29-26-18)13-15(2)20(27)28-21(3,4)5/h8-11H,2,6-7,12-14H2,1,3-5H3 |
| InChIKey | ACRYSNHPRCUPHC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|