C19H29F3N2O3 — CID 156538046
tert-butyl 2-[[3-(9,9,9-trifluorononyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate (PubChem CID 156538046) has the molecular formula C19H29F3N2O3 and a molecular weight of 390.45 g/mol. Its IUPAC name is tert-butyl 2-[[3-(9,9,9-trifluorononyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[[3-(9,9,9-trifluorononyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 156538046 |
| Molecular Formula | C19H29F3N2O3 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | tert-butyl 2-[[3-(9,9,9-trifluorononyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(CCCCCCCCC(F)(F)F)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29F3N2O3/c1-14(17(25)26-18(2,3)4)13-16-23-15(24-27-16)11-9-7-5-6-8-10-12-19(20,21)22/h1,5-13H2,2-4H3 |
| InChIKey | ZLXXTWKUEBQMGF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|