C14H11N3O2 — CID 156538083
5-(isoquinolin-4-ylmethylidene)-3-methylimidazolidine-2,4-dione (PubChem CID 156538083) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 5-(isoquinolin-4-ylmethylidene)-3-methylimidazolidine-2,4-dione.
| Compound Name | 5-(isoquinolin-4-ylmethylidene)-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156538083 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 5-(isoquinolin-4-ylmethylidene)-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)NC(=Cc2cncc3ccccc23)C1=O |
| InChI | InChI=1S/C14H11N3O2/c1-17-13(18)12(16-14(17)19)6-10-8-15-7-9-4-2-3-5-11(9)10/h2-8H,1H3,(H,16,19) |
| InChIKey | WXRNNPXPZSWGLG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|