About 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine
2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine (PubChem CID 156538103) has the molecular formula C11H17FN4O
and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine |
| PubChem CID | 156538103 |
| Molecular Formula | C11H17FN4O |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine |
| SMILES | CO[C@@H]1CCN(c2nccc(N)n2)C[C@]1(C)F |
| InChI | InChI=1S/C11H17FN4O/c1-11(12)7-16(6-4-8(11)17-2)10-14-5-3-9(13)15-10/h3,5,8H,4,6-7H2,1-2H3,(H2,13,14,15)/t8-,11+/m1/s1 |
| InChIKey | CPQOFHGOTYSZEG-KCJUWKMLSA-N |
| XLogP | 1.01 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine?
The IUPAC name of 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine (CID 156538103) is 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine.
What is the SMILES notation for 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine?
The canonical SMILES for 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine is CO[C@@H]1CCN(c2nccc(N)n2)C[C@]1(C)F.
What is the InChIKey of 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine?
The InChIKey is CPQOFHGOTYSZEG-KCJUWKMLSA-N. The full InChI is InChI=1S/C11H17FN4O/c1-11(12)7-16(6-4-8(11)17-2)10-14-5-3-9(13)15-10/h3,5,8H,4,6-7H2,1-2H3,(H2,13,14,15)/t8-,11+/m1/s1.
What are the key properties of 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine?
2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine has a molecular weight of 240.28 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-fluoro-4-methoxy-3-methylpiperidin-1-yl]pyrimidin-4-amine is sourced from PubChem (CID 156538103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).