About 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide
4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide (PubChem CID 156539093) has the molecular formula C13H11BrN4O2S2
and a molecular weight of 399.30 g/mol. Its IUPAC name is 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide |
| PubChem CID | 156539093 |
| Molecular Formula | C13H11BrN4O2S2 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2ncnc3scc(Br)c23)cc1 |
| InChI | InChI=1S/C13H11BrN4O2S2/c14-10-6-21-13-11(10)12(17-7-18-13)16-5-8-1-3-9(4-2-8)22(15,19)20/h1-4,6-7H,5H2,(H2,15,19,20)(H,16,17,18) |
| InChIKey | ZYOGRJYKJFHOGM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide?
The IUPAC name of 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide (CID 156539093) is 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide.
What is the SMILES notation for 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide?
The canonical SMILES for 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide is NS(=O)(=O)c1ccc(CNc2ncnc3scc(Br)c23)cc1.
What is the InChIKey of 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide?
The InChIKey is ZYOGRJYKJFHOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN4O2S2/c14-10-6-21-13-11(10)12(17-7-18-13)16-5-8-1-3-9(4-2-8)22(15,19)20/h1-4,6-7H,5H2,(H2,15,19,20)(H,16,17,18).
What are the key properties of 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide?
4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide has a molecular weight of 399.30 g/mol, XLogP of 2.71, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5-bromothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzenesulfonamide is sourced from PubChem (CID 156539093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).