C19H21ClF3N5O — CID 156539327
(3R)-11-chloro-3-methyl-N-spiro[2.5]octan-6-yl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156539327) has the molecular formula C19H21ClF3N5O and a molecular weight of 427.86 g/mol. Its IUPAC name is (3R)-11-chloro-3-methyl-N-spiro[2.5]octan-6-yl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | (3R)-11-chloro-3-methyl-N-spiro[2.5]octan-6-yl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156539327 |
| Molecular Formula | C19H21ClF3N5O |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (3R)-11-chloro-3-methyl-N-spiro[2.5]octan-6-yl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | C[C@@]1(C(F)(F)F)CN(C(=O)NC2CCC3(CC2)CC3)c2cnc3cc(Cl)nn3c21 |
| InChI | InChI=1S/C19H21ClF3N5O/c1-17(19(21,22)23)10-27(12-9-24-14-8-13(20)26-28(14)15(12)17)16(29)25-11-2-4-18(5-3-11)6-7-18/h8-9,11H,2-7,10H2,1H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | IBKSZVXKYWTXHV-QGZVFWFLSA-N |
| XLogP | 4.46 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |