C20H23ClF3N5O2 — CID 156539444
(3R)-11-chloro-3-methyl-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156539444) has the molecular formula C20H23ClF3N5O2 and a molecular weight of 457.88 g/mol. Its IUPAC name is (3R)-11-chloro-3-methyl-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | (3R)-11-chloro-3-methyl-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156539444 |
| Molecular Formula | C20H23ClF3N5O2 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (3R)-11-chloro-3-methyl-N-(1-oxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | C[C@@]1(C(F)(F)F)CN(C(=O)NC2CCC3(CCCO3)CC2)c2cnc3cc(Cl)nn3c21 |
| InChI | InChI=1S/C20H23ClF3N5O2/c1-18(20(22,23)24)11-28(13-10-25-15-9-14(21)27-29(15)16(13)18)17(30)26-12-3-6-19(7-4-12)5-2-8-31-19/h9-10,12H,2-8,11H2,1H3,(H,26,30)/t12?,18-,19?/m1/s1 |
| InChIKey | MKAHYBPJRUKHRF-NCEKKXQESA-N |
| XLogP | 4.22 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |