About 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide
4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide (PubChem CID 156539573) has the molecular formula C13H14N6O2S
and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide |
| PubChem CID | 156539573 |
| Molecular Formula | C13H14N6O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide |
| SMILES | Cn1ncc2c(NCc3ccc(S(N)(=O)=O)cc3)cnnc21 |
| InChI | InChI=1S/C13H14N6O2S/c1-19-13-11(7-17-19)12(8-16-18-13)15-6-9-2-4-10(5-3-9)22(14,20)21/h2-5,7-8H,6H2,1H3,(H,15,18)(H2,14,20,21) |
| InChIKey | KTSZXTGZAHISLQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide?
The IUPAC name of 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide (CID 156539573) is 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide.
What is the SMILES notation for 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide?
The canonical SMILES for 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide is Cn1ncc2c(NCc3ccc(S(N)(=O)=O)cc3)cnnc21.
What is the InChIKey of 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide?
The InChIKey is KTSZXTGZAHISLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N6O2S/c1-19-13-11(7-17-19)12(8-16-18-13)15-6-9-2-4-10(5-3-9)22(14,20)21/h2-5,7-8H,6H2,1H3,(H,15,18)(H2,14,20,21).
What are the key properties of 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide?
4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide has a molecular weight of 318.36 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1-methylpyrazolo[5,4-c]pyridazin-4-yl)amino]methyl]benzenesulfonamide is sourced from PubChem (CID 156539573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).