C14H14ClF3N4O2 — CID 156539645
tert-butyl 11-chloro-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate (PubChem CID 156539645) has the molecular formula C14H14ClF3N4O2 and a molecular weight of 362.74 g/mol. Its IUPAC name is tert-butyl 11-chloro-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate.
| Compound Name | tert-butyl 11-chloro-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 156539645 |
| Molecular Formula | C14H14ClF3N4O2 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | tert-butyl 11-chloro-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(F)(F)F)c2c1cnc1cc(Cl)nn21 |
| InChI | InChI=1S/C14H14ClF3N4O2/c1-13(2,3)24-12(23)21-6-7(14(16,17)18)11-8(21)5-19-10-4-9(15)20-22(10)11/h4-5,7H,6H2,1-3H3 |
| InChIKey | UFPFPWBJJMRFBR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |