C18H15Cl2N9O — CID 156539751
11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156539751) has the molecular formula C18H15Cl2N9O and a molecular weight of 444.29 g/mol. Its IUPAC name is 11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156539751 |
| Molecular Formula | C18H15Cl2N9O |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C)CN(C(=O)Nc2cnc(-n3nccn3)c(Cl)c2)c2cnc3cc(Cl)nn3c21 |
| InChI | InChI=1S/C18H15Cl2N9O/c1-18(2)9-27(12-8-21-14-6-13(20)26-28(14)15(12)18)17(30)25-10-5-11(19)16(22-7-10)29-23-3-4-24-29/h3-8H,9H2,1-2H3,(H,25,30) |
| InChIKey | FUOQPKPHPXKUJT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |